C19H18N4O — CID 175833951
2-amino-3-cyclopropyl-N-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]prop-2-enamide (PubChem CID 175833951) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-amino-3-cyclopropyl-N-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]prop-2-enamide.
| Compound Name | 2-amino-3-cyclopropyl-N-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175833951 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-amino-3-cyclopropyl-N-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]prop-2-enamide |
| SMILES | NC(=CC1CC1)C(=O)Nc1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C19H18N4O/c20-17(11-12-1-2-12)19(24)23-14-5-3-13(4-6-14)15-7-9-21-18-16(15)8-10-22-18/h3-12H,1-2,20H2,(H,21,22)(H,23,24) |
| InChIKey | ZCUMITUKIWMHNH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|