C24H23ClF2N6 — CID 170450183
6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-chloro-9-methylpurine (PubChem CID 170450183) has the molecular formula C24H23ClF2N6 and a molecular weight of 468.94 g/mol. Its IUPAC name is 6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-chloro-9-methylpurine.
| Compound Name | 6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-chloro-9-methylpurine |
|---|---|
| PubChem CID | 170450183 |
| Molecular Formula | C24H23ClF2N6 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-chloro-9-methylpurine |
| SMILES | CC1CN(C(c2ccc(F)cc2)c2ccc(F)cc2)CCN1c1nc(Cl)nc2c1ncn2C |
| InChI | InChI=1S/C24H23ClF2N6/c1-15-13-32(11-12-33(15)23-20-22(29-24(25)30-23)31(2)14-28-20)21(16-3-7-18(26)8-4-16)17-5-9-19(27)10-6-17/h3-10,14-15,21H,11-13H2,1-2H3 |
| InChIKey | WVASKVPYDYSYTN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |