C27H33F2N9 — CID 177060998
2-[6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-hydrazinylpurin-9-yl]-N,N-dimethylethanamine (PubChem CID 177060998) has the molecular formula C27H33F2N9 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-hydrazinylpurin-9-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-hydrazinylpurin-9-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 177060998 |
| Molecular Formula | C27H33F2N9 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 2-[6-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-hydrazinylpurin-9-yl]-N,N-dimethylethanamine |
| SMILES | CC1CN(C(c2ccc(F)cc2)c2ccc(F)cc2)CCN1c1nc(NN)nc2c1ncn2CCN(C)C |
| InChI | InChI=1S/C27H33F2N9/c1-18-16-36(24(19-4-8-21(28)9-5-19)20-6-10-22(29)11-7-20)14-15-38(18)26-23-25(32-27(33-26)34-30)37(17-31-23)13-12-35(2)3/h4-11,17-18,24H,12-16,30H2,1-3H3,(H,32,33,34) |
| InChIKey | VQLFCEPREDJUCF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|