C27H27ClF4N8 — CID 170553881
[6-chloro-4-[(2S,5R)-5-ethyl-4-[(4-fluorophenyl)-[5-(trifluoromethyl)-2-pyridinyl]methyl]-2-methylpiperazin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]hydrazine (PubChem CID 170553881) has the molecular formula C27H27ClF4N8 and a molecular weight of 575.01 g/mol. Its IUPAC name is [6-chloro-4-[(2S,5R)-5-ethyl-4-[(4-fluorophenyl)-[5-(trifluoromethyl)-2-pyridinyl]methyl]-2-methylpiperazin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-chloro-4-[(2S,5R)-5-ethyl-4-[(4-fluorophenyl)-[5-(trifluoromethyl)-2-pyridinyl]methyl]-2-methylpiperazin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 170553881 |
| Molecular Formula | C27H27ClF4N8 |
| Molecular Weight | 575.01 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | [6-chloro-4-[(2S,5R)-5-ethyl-4-[(4-fluorophenyl)-[5-(trifluoromethyl)-2-pyridinyl]methyl]-2-methylpiperazin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]hydrazine |
| SMILES | CC[C@@H]1CN(c2nc(NN)nc3ccc(Cl)nc23)[C@@H](C)CN1C(c1ccc(F)cc1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C27H27ClF4N8/c1-3-19-14-39(25-23-20(10-11-22(28)36-23)35-26(37-25)38-33)15(2)13-40(19)24(16-4-7-18(29)8-5-16)21-9-6-17(12-34-21)27(30,31)32/h4-12,15,19,24H,3,13-14,33H2,1-2H3,(H,35,37,38)/t15-,19+,24?/m0/s1 |
| InChIKey | JWEBPQSHOKBNKM-PKEARPMDSA-N |
| XLogP | 5.60 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|