C26H28F2N8 — CID 171048498
[4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]pteridin-2-yl]hydrazine (PubChem CID 171048498) has the molecular formula C26H28F2N8 and a molecular weight of 490.56 g/mol. Its IUPAC name is [4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]pteridin-2-yl]hydrazine.
| Compound Name | [4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]pteridin-2-yl]hydrazine |
|---|---|
| PubChem CID | 171048498 |
| Molecular Formula | C26H28F2N8 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]pteridin-2-yl]hydrazine |
| SMILES | CC[C@@H]1CN(c2nc(NN)nc3nccnc23)[C@@H](C)CN1C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28F2N8/c1-3-21-15-35(25-22-24(31-13-12-30-22)32-26(33-25)34-29)16(2)14-36(21)23(17-4-8-19(27)9-5-17)18-6-10-20(28)11-7-18/h4-13,16,21,23H,3,14-15,29H2,1-2H3,(H,31,32,33,34)/t16-,21+/m0/s1 |
| InChIKey | QLYICLZGEGFYAR-HRAATJIYSA-N |
| XLogP | 4.06 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|