C32H41F2N9O2 — CID 170533782
tert-butyl N-[2-[6-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-8-deuterio-2-hydrazinylpurin-9-yl]ethyl]-N-methylcarbamate (PubChem CID 170533782) has the molecular formula C32H41F2N9O2 and a molecular weight of 622.74 g/mol. Its IUPAC name is tert-butyl N-[2-[6-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-8-deuterio-2-hydrazinylpurin-9-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[6-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-8-deuterio-2-hydrazinylpurin-9-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170533782 |
| Molecular Formula | C32H41F2N9O2 |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | tert-butyl N-[2-[6-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-8-deuterio-2-hydrazinylpurin-9-yl]ethyl]-N-methylcarbamate |
| SMILES | [2H]c1nc2c(N3C[C@@H](C)N(C(c4ccc(F)cc4)c4ccc(F)cc4)C[C@@H]3C)nc(NN)nc2n1CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H41F2N9O2/c1-20-18-43(21(2)17-42(20)27(22-7-11-24(33)12-8-22)23-9-13-25(34)14-10-23)29-26-28(37-30(38-29)39-35)41(19-36-26)16-15-40(6)31(44)45-32(3,4)5/h7-14,19-21,27H,15-18,35H2,1-6H3,(H,37,38,39)/t20-,21+/m1/s1/i19D |
| InChIKey | QMBDUIJPRGGEBB-SLFYYHPZSA-N |
| XLogP | 4.95 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|