C31H40ClF2N9O2 — CID 170445727
tert-butyl N-[2-[4-[(2S,5R)-4-[(4-chlorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]ethyl]-N-methylcarbamate (PubChem CID 170445727) has the molecular formula C31H40ClF2N9O2 and a molecular weight of 644.17 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2S,5R)-4-[(4-chlorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-[(2S,5R)-4-[(4-chlorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170445727 |
| Molecular Formula | C31H40ClF2N9O2 |
| Molecular Weight | 644.17 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | tert-butyl N-[2-[4-[(2S,5R)-4-[(4-chlorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]ethyl]-N-methylcarbamate |
| SMILES | C[C@@H]1CN(c2nc3nncn3c3c2ncn3CCN(C)C(=O)OC(C)(C)C)[C@@H](C)CN1C(c1ccc(Cl)cc1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C31H40ClF2N9O2/c1-19-16-42(20(2)15-41(19)25(22-13-31(33,34)14-22)21-7-9-23(32)10-8-21)26-24-27(43-18-36-38-28(43)37-26)40(17-35-24)12-11-39(6)29(44)45-30(3,4)5/h7-10,17-20,22,25H,11-16H2,1-6H3/t19-,20+,25?/m1/s1 |
| InChIKey | WXNFPXRKJUQBEK-DRNDDYJUSA-N |
| XLogP | 5.68 |
| TPSA | 96.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.17 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |