C28H26N8O2 — CID 170451004
12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-10-prop-2-ynoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 170451004) has the molecular formula C28H26N8O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-10-prop-2-ynoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-10-prop-2-ynoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 170451004 |
| Molecular Formula | C28H26N8O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-10-prop-2-ynoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | C#CCOc1cc(-c2ccc(N3CC4CC(C3)N4Cc3ccc(OC)nc3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C28H26N8O2/c1-3-8-38-22-10-23(27-24-13-31-32-28(24)33-36(27)17-22)19-5-6-25(29-12-19)34-15-20-9-21(16-34)35(20)14-18-4-7-26(37-2)30-11-18/h1,4-7,10-13,17,20-21H,8-9,14-16H2,2H3,(H,32,33) |
| InChIKey | GIEKUAHWSSIMEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|