C28H30N8O3 — CID 166005898
10-(2-methoxyethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 166005898) has the molecular formula C28H30N8O3 and a molecular weight of 526.60 g/mol. Its IUPAC name is 10-(2-methoxyethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 10-(2-methoxyethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 166005898 |
| Molecular Formula | C28H30N8O3 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 10-(2-methoxyethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | COCCOc1cc(-c2ccc(N3CC4CC(C3)N4Cc3ccc(OC)nc3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C28H30N8O3/c1-37-7-8-39-22-10-23(27-24-13-31-32-28(24)33-36(27)17-22)19-4-5-25(29-12-19)34-15-20-9-21(16-34)35(20)14-18-3-6-26(38-2)30-11-18/h3-6,10-13,17,20-21H,7-9,14-16H2,1-2H3,(H,32,33) |
| InChIKey | KOMFRAZVUVLOGV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|