C27H25N9O2 — CID 166005905
10-(isocyanomethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 166005905) has the molecular formula C27H25N9O2 and a molecular weight of 507.56 g/mol. Its IUPAC name is 10-(isocyanomethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 10-(isocyanomethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 166005905 |
| Molecular Formula | C27H25N9O2 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 10-(isocyanomethoxy)-12-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | [C-]#[N+]COc1cc(-c2ccc(N3CC4CC(C3)N4Cc3ccc(OC)nc3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C27H25N9O2/c1-28-16-38-21-8-22(26-23-11-31-32-27(23)33-36(26)15-21)18-4-5-24(29-10-18)34-13-19-7-20(14-34)35(19)12-17-3-6-25(37-2)30-9-17/h3-6,8-11,15,19-20H,7,12-14,16H2,2H3,(H,32,33) |
| InChIKey | RVEOHPWDTWWSJN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|