C19H10Cl2N2O3 — CID 170451691
5-(3,5-dichlorobenzoyl)pyrido[4,3-b]indole-7-carboxylic acid (PubChem CID 170451691) has the molecular formula C19H10Cl2N2O3 and a molecular weight of 385.21 g/mol. Its IUPAC name is 5-(3,5-dichlorobenzoyl)pyrido[4,3-b]indole-7-carboxylic acid.
| Compound Name | 5-(3,5-dichlorobenzoyl)pyrido[4,3-b]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 170451691 |
| Molecular Formula | C19H10Cl2N2O3 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 5-(3,5-dichlorobenzoyl)pyrido[4,3-b]indole-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c3cnccc3n(C(=O)c3cc(Cl)cc(Cl)c3)c2c1 |
| InChI | InChI=1S/C19H10Cl2N2O3/c20-12-5-11(6-13(21)8-12)18(24)23-16-3-4-22-9-15(16)14-2-1-10(19(25)26)7-17(14)23/h1-9H,(H,25,26) |
| InChIKey | OODYDNHMHOSRMX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |