C21H19ClN2O3 — CID 170451906
[2-(3-amino-2,5-dimethoxyanilino)-5-chlorophenyl]-phenylmethanone (PubChem CID 170451906) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is [2-(3-amino-2,5-dimethoxyanilino)-5-chlorophenyl]-phenylmethanone.
| Compound Name | [2-(3-amino-2,5-dimethoxyanilino)-5-chlorophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 170451906 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [2-(3-amino-2,5-dimethoxyanilino)-5-chlorophenyl]-phenylmethanone |
| SMILES | COc1cc(N)c(OC)c(Nc2ccc(Cl)cc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-26-15-11-17(23)21(27-2)19(12-15)24-18-9-8-14(22)10-16(18)20(25)13-6-4-3-5-7-13/h3-12,24H,23H2,1-2H3 |
| InChIKey | NBWKIVUUNCOQCN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|