C12H12N4S — CID 170452906
5-amino-1-naphthalen-1-yl-1,2,4-triazolidine-3-thione (PubChem CID 170452906) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 5-amino-1-naphthalen-1-yl-1,2,4-triazolidine-3-thione.
| Compound Name | 5-amino-1-naphthalen-1-yl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 170452906 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-amino-1-naphthalen-1-yl-1,2,4-triazolidine-3-thione |
| SMILES | NC1NC(=S)NN1c1cccc2ccccc12 |
| InChI | InChI=1S/C12H12N4S/c13-11-14-12(17)15-16(11)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H,13H2,(H2,14,15,17) |
| InChIKey | WDENASNWKSNPNG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|