C26H44O12S — CID 170454880
9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2R,3S)-3-sulfooxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid (PubChem CID 170454880) has the molecular formula C26H44O12S and a molecular weight of 580.69 g/mol. Its IUPAC name is 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2R,3S)-3-sulfooxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid.
| Compound Name | 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2R,3S)-3-sulfooxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
|---|---|
| PubChem CID | 170454880 |
| Molecular Formula | C26H44O12S |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2R,3S)-3-sulfooxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)OS(=O)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H44O12S/c1-16(13-23(29)35-11-9-7-5-4-6-8-10-22(27)28)12-20-25(31)24(30)19(15-36-20)14-21-26(37-21)17(2)18(3)38-39(32,33)34/h13,17-21,24-26,30-31H,4-12,14-15H2,1-3H3,(H,27,28)(H,32,33,34)/b16-13+/t17-,18-,19-,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | JFOOOROWRLJXGR-HBBNESRFSA-N |
| XLogP | 2.42 |
| TPSA | 189.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|