C26H45ClO9 — CID 135391012
9-[(E)-4-[(2S,3R,4R,5S)-5-(3-chloro-2,5-dihydroxy-4-methylhexyl)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid (PubChem CID 135391012) has the molecular formula C26H45ClO9 and a molecular weight of 537.09 g/mol. Its IUPAC name is 9-[(E)-4-[(2S,3R,4R,5S)-5-(3-chloro-2,5-dihydroxy-4-methylhexyl)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid.
| Compound Name | 9-[(E)-4-[(2S,3R,4R,5S)-5-(3-chloro-2,5-dihydroxy-4-methylhexyl)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
|---|---|
| PubChem CID | 135391012 |
| Molecular Formula | C26H45ClO9 |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 9-[(E)-4-[(2S,3R,4R,5S)-5-(3-chloro-2,5-dihydroxy-4-methylhexyl)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@H](CC(O)C(Cl)C(C)C(C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H45ClO9/c1-16(13-23(32)35-11-9-7-5-4-6-8-10-22(30)31)12-21-26(34)25(33)19(15-36-21)14-20(29)24(27)17(2)18(3)28/h13,17-21,24-26,28-29,33-34H,4-12,14-15H2,1-3H3,(H,30,31)/b16-13+/t17?,18?,19-,20?,21-,24?,25+,26-/m0/s1 |
| InChIKey | XJXYEEDNRCGGMO-KJOJXFELSA-N |
| XLogP | 2.79 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|