C26H44NaO9 — CID 131866370
CID 131866370 (PubChem CID 131866370) has the molecular formula C26H44NaO9 and a molecular weight of 523.62 g/mol.
| Compound Name | CID 131866370 |
|---|---|
| PubChem CID | 131866370 |
| Molecular Formula | C26H44NaO9 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | — |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@@H]2C[C@H]([C@@H](O)[C@@H](C)[C@H](C)O)O[C@H]2[C@H]1O.[Na] |
| InChI | InChI=1S/C26H44O9.Na/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)26-19(15-34-20)14-21(35-26)24(31)17(2)18(3)27;/h13,17-21,24-27,31-32H,4-12,14-15H2,1-3H3,(H,28,29);/b16-13+;/t17-,18-,19-,20-,21+,24-,25-,26+;/m0./s1 |
| InChIKey | FEEMOESUBWDFBN-BWHRDUBESA-N |
| XLogP | 2.21 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|