C21H36O7 — CID 173329101
methyl 9-[(E)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyloxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate (PubChem CID 173329101) has the molecular formula C21H36O7 and a molecular weight of 400.51 g/mol. Its IUPAC name is methyl 9-[(E)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyloxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate.
| Compound Name | methyl 9-[(E)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyloxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
|---|---|
| PubChem CID | 173329101 |
| Molecular Formula | C21H36O7 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | methyl 9-[(E)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-methyloxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCOC(=O)/C=C(\C)C[C@@H]1OC[C@@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H36O7/c1-15(12-17-21(25)20(24)16(2)14-28-17)13-19(23)27-11-9-7-5-4-6-8-10-18(22)26-3/h13,16-17,20-21,24-25H,4-12,14H2,1-3H3/b15-13+/t16-,17+,20-,21+/m1/s1 |
| InChIKey | RBLROPBUELPSSO-HKQSZWICSA-N |
| XLogP | 2.53 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|