C20H34O7 — CID 173329268
methyl 9-[(E)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate (PubChem CID 173329268) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 9-[(E)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate.
| Compound Name | methyl 9-[(E)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
|---|---|
| PubChem CID | 173329268 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | methyl 9-[(E)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCOC(=O)/C=C(\C)C[C@@H]1OCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H34O7/c1-15(13-17-20(24)16(21)10-12-26-17)14-19(23)27-11-8-6-4-3-5-7-9-18(22)25-2/h14,16-17,20-21,24H,3-13H2,1-2H3/b15-14+/t16-,17+,20-/m1/s1 |
| InChIKey | ZBKMAGXFAZXAGX-JUZHTCOWSA-N |
| XLogP | 2.28 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|