C17H20N2O7S — CID 170455552
(2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 170455552) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 170455552 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1C(=O)N2[C@@H]1S(=O)C(C)(C)[C@@H]2C(=O)O |
| InChI | InChI=1S/C17H20N2O7S/c1-17(2)12(16(22)23)19-14(21)11(15(19)27(17)24)18-13(20)10-8(25-3)6-5-7-9(10)26-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/t11-,12+,15-,27?/m1/s1 |
| InChIKey | QFGLPNUOEGWIOK-QBZXYJIQSA-N |
| XLogP | -0.04 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |