C15H18N2O5S2 — CID 88813333
methyl (2S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(phenoxysulfanylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88813333) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl (2S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(phenoxysulfanylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (2S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(phenoxysulfanylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88813333 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | methyl (2S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(phenoxysulfanylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N2C(=O)[C@@H](NSOc3ccccc3)[C@H]2S(=O)C1(C)C |
| InChI | InChI=1S/C15H18N2O5S2/c1-15(2)11(14(19)21-3)17-12(18)10(13(17)24(15)20)16-23-22-9-7-5-4-6-8-9/h4-8,10-11,13,16H,1-3H3/t10-,11+,13-,24?/m1/s1 |
| InChIKey | BBLCWNZZMAMLFE-NRSGJQGQSA-N |
| XLogP | 0.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|