C31H28N2O6S — CID 22788373
trityl (5S)-6-(2,5-dioxopyrrolidin-1-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22788373) has the molecular formula C31H28N2O6S and a molecular weight of 556.64 g/mol. Its IUPAC name is trityl (5S)-6-(2,5-dioxopyrrolidin-1-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | trityl (5S)-6-(2,5-dioxopyrrolidin-1-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22788373 |
| Molecular Formula | C31H28N2O6S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | trityl (5S)-6-(2,5-dioxopyrrolidin-1-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)C(C(=O)OC(c2ccccc2)(c2ccccc2)c2ccccc2)N2C(=O)C(N3C(=O)CCC3=O)[C@@H]2S1=O |
| InChI | InChI=1S/C31H28N2O6S/c1-30(2)26(33-27(36)25(28(33)40(30)38)32-23(34)18-19-24(32)35)29(37)39-31(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,25-26,28H,18-19H2,1-2H3/t25?,26?,28-,40?/m0/s1 |
| InChIKey | PVJSJCCBMRTBQJ-MJBSYVBBSA-N |
| XLogP | 3.12 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|