C22H27N3O4 — CID 17045660
N-(2,5-dimethylphenyl)-4-oxo-4-[2-(2-propan-2-yloxybenzoyl)hydrazinyl]butanamide (PubChem CID 17045660) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-oxo-4-[2-(2-propan-2-yloxybenzoyl)hydrazinyl]butanamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-oxo-4-[2-(2-propan-2-yloxybenzoyl)hydrazinyl]butanamide |
|---|---|
| PubChem CID | 17045660 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-oxo-4-[2-(2-propan-2-yloxybenzoyl)hydrazinyl]butanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NNC(=O)c2ccccc2OC(C)C)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-14(2)29-19-8-6-5-7-17(19)22(28)25-24-21(27)12-11-20(26)23-18-13-15(3)9-10-16(18)4/h5-10,13-14H,11-12H2,1-4H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | SVFHJBAPAQHVLF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|