C25H19ClN4O2 — CID 170460968
9H-fluoren-9-ylmethyl N-[4-(6-chloroimidazo[1,2-b]pyridazin-3-yl)but-3-ynyl]carbamate (PubChem CID 170460968) has the molecular formula C25H19ClN4O2 and a molecular weight of 442.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(6-chloroimidazo[1,2-b]pyridazin-3-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(6-chloroimidazo[1,2-b]pyridazin-3-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460968 |
| Molecular Formula | C25H19ClN4O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(6-chloroimidazo[1,2-b]pyridazin-3-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnc2ccc(Cl)nn12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H19ClN4O2/c26-23-12-13-24-28-15-17(30(24)29-23)7-5-6-14-27-25(31)32-16-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-4,8-13,15,22H,6,14,16H2,(H,27,31) |
| InChIKey | XILPZFUJLUFCCN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|