C25H21N3O4S — CID 170461347
5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-methylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 170461347) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-methylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-methylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170461347 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-methylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CSc1ncc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c(C(=O)O)n1 |
| InChI | InChI=1S/C25H21N3O4S/c1-33-24-27-14-16(22(28-24)23(29)30)8-6-7-13-26-25(31)32-15-21-19-11-4-2-9-17(19)18-10-3-5-12-20(18)21/h2-5,9-12,14,21H,7,13,15H2,1H3,(H,26,31)(H,29,30) |
| InChIKey | DPZRXASDGKGQCV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|