C9H11ClN4 — CID 170464082
6-chloro-4-[4-(methylamino)but-1-ynyl]pyridazin-3-amine (PubChem CID 170464082) has the molecular formula C9H11ClN4 and a molecular weight of 210.67 g/mol. Its IUPAC name is 6-chloro-4-[4-(methylamino)but-1-ynyl]pyridazin-3-amine.
| Compound Name | 6-chloro-4-[4-(methylamino)but-1-ynyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 170464082 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 6-chloro-4-[4-(methylamino)but-1-ynyl]pyridazin-3-amine |
| SMILES | CNCCC#Cc1cc(Cl)nnc1N |
| InChI | InChI=1S/C9H11ClN4/c1-12-5-3-2-4-7-6-8(10)13-14-9(7)11/h6,12H,3,5H2,1H3,(H2,11,14) |
| InChIKey | VDROKPDOOPBNKW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|