C11H11BrN2S — CID 170466430
[3-(4-bromobut-1-ynyl)phenyl]thiourea (PubChem CID 170466430) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is [3-(4-bromobut-1-ynyl)phenyl]thiourea.
| Compound Name | [3-(4-bromobut-1-ynyl)phenyl]thiourea |
|---|---|
| PubChem CID | 170466430 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | [3-(4-bromobut-1-ynyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(C#CCCBr)c1 |
| InChI | InChI=1S/C11H11BrN2S/c12-7-2-1-4-9-5-3-6-10(8-9)14-11(13)15/h3,5-6,8H,2,7H2,(H3,13,14,15) |
| InChIKey | SWFOCPVDKQSCJP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|