C12H8BrNO2 — CID 170466846
5-(4-bromobut-1-ynyl)isoindole-1,3-dione (PubChem CID 170466846) has the molecular formula C12H8BrNO2 and a molecular weight of 278.11 g/mol. Its IUPAC name is 5-(4-bromobut-1-ynyl)isoindole-1,3-dione.
| Compound Name | 5-(4-bromobut-1-ynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170466846 |
| Molecular Formula | C12H8BrNO2 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 5-(4-bromobut-1-ynyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C#CCCBr)ccc21 |
| InChI | InChI=1S/C12H8BrNO2/c13-6-2-1-3-8-4-5-9-10(7-8)12(16)14-11(9)15/h4-5,7H,2,6H2,(H,14,15,16) |
| InChIKey | AHHWAACHHRWDPK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|