C15H18N2O — CID 170473848
4-(2-piperidin-1-ylphenyl)but-3-ynamide (PubChem CID 170473848) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(2-piperidin-1-ylphenyl)but-3-ynamide.
| Compound Name | 4-(2-piperidin-1-ylphenyl)but-3-ynamide |
|---|---|
| PubChem CID | 170473848 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-(2-piperidin-1-ylphenyl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C15H18N2O/c16-15(18)10-6-8-13-7-2-3-9-14(13)17-11-4-1-5-12-17/h2-3,7,9H,1,4-5,10-12H2,(H2,16,18) |
| InChIKey | BHUJFTHKTXXTTD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|