C8H10N2O3 — CID 170476227
4-hydroxy-5-(4-hydroxybut-1-enyl)-1H-pyrimidin-6-one (PubChem CID 170476227) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 4-hydroxy-5-(4-hydroxybut-1-enyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-(4-hydroxybut-1-enyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170476227 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 4-hydroxy-5-(4-hydroxybut-1-enyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(O)c1C=CCCO |
| InChI | InChI=1S/C8H10N2O3/c11-4-2-1-3-6-7(12)9-5-10-8(6)13/h1,3,5,11H,2,4H2,(H2,9,10,12,13) |
| InChIKey | XCECFSFQBBDXPB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |