C8H10N2O2S — CID 170477983
4-hydroxy-5-(4-sulfanylbut-1-enyl)-1H-pyrimidin-6-one (PubChem CID 170477983) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 4-hydroxy-5-(4-sulfanylbut-1-enyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-(4-sulfanylbut-1-enyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170477983 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 4-hydroxy-5-(4-sulfanylbut-1-enyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(O)c1C=CCCS |
| InChI | InChI=1S/C8H10N2O2S/c11-7-6(3-1-2-4-13)8(12)10-5-9-7/h1,3,5,13H,2,4H2,(H2,9,10,11,12) |
| InChIKey | XRZUDNDZNNABDB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|