C10H9F3N2O3 — CID 170501498
methyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate (PubChem CID 170501498) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is methyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate.
| Compound Name | methyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate |
|---|---|
| PubChem CID | 170501498 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | methyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate |
| SMILES | COC(=O)CC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C10H9F3N2O3/c1-18-7(16)4-2-3-6-8(10(11,12)13)14-5-15-9(6)17/h2-3,5H,4H2,1H3,(H,14,15,17) |
| InChIKey | HKOMYZIHVJMNHB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |