C7H5F3N2O3 — CID 136758159
2-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136758159) has the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. Its IUPAC name is 2-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136758159 |
| Molecular Formula | C7H5F3N2O3 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]acetic acid |
| SMILES | O=C(O)Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C7H5F3N2O3/c8-7(9,10)5-3(1-4(13)14)6(15)12-2-11-5/h2H,1H2,(H,13,14)(H,11,12,15) |
| InChIKey | GGDAZLNFJBYTHZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |