C8H6F3NO3 — CID 131472860
2-[4-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]acetic acid (PubChem CID 131472860) has the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. Its IUPAC name is 2-[4-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]acetic acid.
| Compound Name | 2-[4-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 131472860 |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-[4-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c[nH]c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C8H6F3NO3/c9-8(10,11)6-2-5(13)4(3-12-6)1-7(14)15/h2-3H,1H2,(H,12,13)(H,14,15) |
| InChIKey | ITNFYXMGHQGBSA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |