C10H12FNOS — CID 170478403
4-(5-fluoro-2-methoxy-3-pyridinyl)but-3-ene-1-thiol (PubChem CID 170478403) has the molecular formula C10H12FNOS and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxy-3-pyridinyl)but-3-ene-1-thiol.
| Compound Name | 4-(5-fluoro-2-methoxy-3-pyridinyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478403 |
| Molecular Formula | C10H12FNOS |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-(5-fluoro-2-methoxy-3-pyridinyl)but-3-ene-1-thiol |
| SMILES | COc1ncc(F)cc1C=CCCS |
| InChI | InChI=1S/C10H12FNOS/c1-13-10-8(4-2-3-5-14)6-9(11)7-12-10/h2,4,6-7,14H,3,5H2,1H3 |
| InChIKey | VAQGEMONOJLNSL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|