C11H13NO4S2 — CID 170479254
4-(4-methylsulfonyl-2-nitrophenyl)but-3-ene-1-thiol (PubChem CID 170479254) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(4-methylsulfonyl-2-nitrophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(4-methylsulfonyl-2-nitrophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170479254 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-(4-methylsulfonyl-2-nitrophenyl)but-3-ene-1-thiol |
| SMILES | CS(=O)(=O)c1ccc(C=CCCS)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13NO4S2/c1-18(15,16)10-6-5-9(4-2-3-7-17)11(8-10)12(13)14/h2,4-6,8,17H,3,7H2,1H3 |
| InChIKey | YQOQIKXCQIWSTN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|