C13H16N2OS — CID 170480245
S-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-enyl] ethanethioate (PubChem CID 170480245) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is S-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480245 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | S-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cnc2c(c1)CCN2 |
| InChI | InChI=1S/C13H16N2OS/c1-10(16)17-7-3-2-4-11-8-12-5-6-14-13(12)15-9-11/h2,4,8-9H,3,5-7H2,1H3,(H,14,15) |
| InChIKey | XLIVAUZVXKBAQG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|