C12H12N2O3S — CID 170480296
S-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enyl] ethanethioate (PubChem CID 170480296) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is S-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480296 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | S-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cnc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-8(15)18-5-3-2-4-9-6-10-11(13-7-9)14-12(16)17-10/h2,4,6-7H,3,5H2,1H3,(H,13,14,16) |
| InChIKey | MBNUPPBMYSSPTG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|