C10H11N3O2 — CID 170487116
6-(4-aminobut-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 170487116) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 6-(4-aminobut-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 6-(4-aminobut-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 170487116 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 6-(4-aminobut-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | NCCC=Cc1cnc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H11N3O2/c11-4-2-1-3-7-5-8-9(12-6-7)13-10(14)15-8/h1,3,5-6H,2,4,11H2,(H,12,13,14) |
| InChIKey | AZNFYSCYZNCOLK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |