About 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one
6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 118654391) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 118654391 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | CC(C)c1cnc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H10N2O2/c1-5(2)6-3-7-8(10-4-6)11-9(12)13-7/h3-5H,1-2H3,(H,10,11,12) |
| InChIKey | BOHVXUCCXKHOOR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 118654391) is 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is CC(C)c1cnc2[nH]c(=O)oc2c1.
What is the InChIKey of 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is BOHVXUCCXKHOOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-5(2)6-3-7-8(10-4-6)11-9(12)13-7/h3-5H,1-2H3,(H,10,11,12).
What are the key properties of 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 178.19 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 118654391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).