About CID 67884406
CID 67884406 (PubChem CID 67884406) has the molecular formula C6H4N2NaO2
and a molecular weight of 159.10 g/mol.
Molecular Properties
| Compound Name | CID 67884406 |
| PubChem CID | 67884406 |
| Molecular Formula | C6H4N2NaO2 |
| Molecular Weight | 159.10 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c2ncccc2o1.[Na] |
| InChI | InChI=1S/C6H4N2O2.Na/c9-6-8-5-4(10-6)2-1-3-7-5;/h1-3H,(H,7,8,9); |
| InChIKey | JLACEHILVXSURQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.10 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 67884406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67884406?
The IUPAC name of CID 67884406 (CID 67884406) is not available.
What is the SMILES notation for CID 67884406?
The canonical SMILES for CID 67884406 is O=c1[nH]c2ncccc2o1.[Na].
What is the InChIKey of CID 67884406?
The InChIKey is JLACEHILVXSURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2.Na/c9-6-8-5-4(10-6)2-1-3-7-5;/h1-3H,(H,7,8,9);.
What are the key properties of CID 67884406?
CID 67884406 has a molecular weight of 159.10 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67884406 is sourced from PubChem (CID 67884406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).