C14H21N3O3 — CID 131728559
2-ethylhexanamide;3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 131728559) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-ethylhexanamide;3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 2-ethylhexanamide;3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 131728559 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-ethylhexanamide;3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | CCCCC(CC)C(N)=O.O=c1[nH]c2ncccc2o1 |
| InChI | InChI=1S/C8H17NO.C6H4N2O2/c1-3-5-6-7(4-2)8(9)10;9-6-8-5-4(10-6)2-1-3-7-5/h7H,3-6H2,1-2H3,(H2,9,10);1-3H,(H,7,8,9) |
| InChIKey | NBWLKGZVGLSCON-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |