About 2-propylhexanamide;pyridine
2-propylhexanamide;pyridine (PubChem CID 67753148) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-propylhexanamide;pyridine.
Molecular Properties
| Compound Name | 2-propylhexanamide;pyridine |
| PubChem CID | 67753148 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-propylhexanamide;pyridine |
| SMILES | CCCCC(CCC)C(N)=O.c1ccncc1 |
| InChI | InChI=1S/C9H19NO.C5H5N/c1-3-5-7-8(6-4-2)9(10)11;1-2-4-6-5-3-1/h8H,3-7H2,1-2H3,(H2,10,11);1-5H |
| InChIKey | UOBSHYJGICAJAA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylhexanamide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexanamide;pyridine?
The IUPAC name of 2-propylhexanamide;pyridine (CID 67753148) is 2-propylhexanamide;pyridine.
What is the SMILES notation for 2-propylhexanamide;pyridine?
The canonical SMILES for 2-propylhexanamide;pyridine is CCCCC(CCC)C(N)=O.c1ccncc1.
What is the InChIKey of 2-propylhexanamide;pyridine?
The InChIKey is UOBSHYJGICAJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C5H5N/c1-3-5-7-8(6-4-2)9(10)11;1-2-4-6-5-3-1/h8H,3-7H2,1-2H3,(H2,10,11);1-5H.
What are the key properties of 2-propylhexanamide;pyridine?
2-propylhexanamide;pyridine has a molecular weight of 236.36 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexanamide;pyridine is sourced from PubChem (CID 67753148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).