C10H14N4O — CID 170487393
5-(4-aminobut-1-enyl)pyridine-3-carbohydrazide (PubChem CID 170487393) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-(4-aminobut-1-enyl)pyridine-3-carbohydrazide.
| Compound Name | 5-(4-aminobut-1-enyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 170487393 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-(4-aminobut-1-enyl)pyridine-3-carbohydrazide |
| SMILES | NCCC=Cc1cncc(C(=O)NN)c1 |
| InChI | InChI=1S/C10H14N4O/c11-4-2-1-3-8-5-9(7-13-6-8)10(15)14-12/h1,3,5-7H,2,4,11-12H2,(H,14,15) |
| InChIKey | XHFDOODLCSTERY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|