C10H14N2O — CID 170486715
[5-(4-aminobut-1-enyl)-3-pyridinyl]methanol (PubChem CID 170486715) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is [5-(4-aminobut-1-enyl)-3-pyridinyl]methanol.
| Compound Name | [5-(4-aminobut-1-enyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 170486715 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [5-(4-aminobut-1-enyl)-3-pyridinyl]methanol |
| SMILES | NCCC=Cc1cncc(CO)c1 |
| InChI | InChI=1S/C10H14N2O/c11-4-2-1-3-9-5-10(8-13)7-12-6-9/h1,3,5-7,13H,2,4,8,11H2 |
| InChIKey | IVQYSYQZKBUZSK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |