C11H12BrNO2S — CID 170481200
S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)but-3-enyl] ethanethioate (PubChem CID 170481200) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170481200 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(Br)c[nH]c1=O |
| InChI | InChI=1S/C11H12BrNO2S/c1-8(14)16-5-3-2-4-9-6-10(12)7-13-11(9)15/h2,4,6-7H,3,5H2,1H3,(H,13,15) |
| InChIKey | MNRRASGAXLPQTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|