C11H14BrNO4S — CID 171876995
S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876995) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876995 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | S-[4-(5-bromo-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(Br)c[nH]c1=O |
| InChI | InChI=1S/C11H14BrNO4S/c1-6(14)18-3-2-9(15)10(16)8-4-7(12)5-13-11(8)17/h4-5,9-10,15-16H,2-3H2,1H3,(H,13,17) |
| InChIKey | SKPBBDWBLDIJRF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|