4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid

C11H10N2O2S — CID 170483730

IUPAC4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid
SMILESNc1nc2cc(C=CCC(=O)O)ccc2s1
InChIInChI=1S/C11H10N2O2S/c12-11-13-8-6-7(2-1-3-10(14)15)4-5-9(8)16-11/h1-2,4-6H,3H2,(H2,12,13)(H,14,15)
InChIKeyDVJJWGYJNWSYIX-UHFFFAOYSA-N
MW234.28 g/mol
LogP2.37
Rot. Bonds3

About 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid

4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid (PubChem CID 170483730) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid.

Molecular Properties

Compound Name4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid
PubChem CID170483730
Molecular FormulaC11H10N2O2S
Molecular Weight234.28 g/mol
Exact Mass234.05
IUPAC Name4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid
SMILESNc1nc2cc(C=CCC(=O)O)ccc2s1
InChIInChI=1S/C11H10N2O2S/c12-11-13-8-6-7(2-1-3-10(14)15)4-5-9(8)16-11/h1-2,4-6H,3H2,(H2,12,13)(H,14,15)
InChIKeyDVJJWGYJNWSYIX-UHFFFAOYSA-N
XLogP2.37
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.28
LogP ≤ 52.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid?
The IUPAC name of 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid (CID 170483730) is 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid.
What is the SMILES notation for 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid?
The canonical SMILES for 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid is Nc1nc2cc(C=CCC(=O)O)ccc2s1.
What is the InChIKey of 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid?
The InChIKey is DVJJWGYJNWSYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c12-11-13-8-6-7(2-1-3-10(14)15)4-5-9(8)16-11/h1-2,4-6H,3H2,(H2,12,13)(H,14,15).
What are the key properties of 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid?
4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid has a molecular weight of 234.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid is sourced from PubChem (CID 170483730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).