C11H10N2O2S — CID 170483730
4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid (PubChem CID 170483730) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid.
| Compound Name | 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid |
|---|---|
| PubChem CID | 170483730 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-(2-amino-1,3-benzothiazol-5-yl)but-3-enoic acid |
| SMILES | Nc1nc2cc(C=CCC(=O)O)ccc2s1 |
| InChI | InChI=1S/C11H10N2O2S/c12-11-13-8-6-7(2-1-3-10(14)15)4-5-9(8)16-11/h1-2,4-6H,3H2,(H2,12,13)(H,14,15) |
| InChIKey | DVJJWGYJNWSYIX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |