C11H13N3S — CID 170487111
6-(4-aminobut-1-enyl)-1,3-benzothiazol-2-amine (PubChem CID 170487111) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-(4-aminobut-1-enyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(4-aminobut-1-enyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 170487111 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-(4-aminobut-1-enyl)-1,3-benzothiazol-2-amine |
| SMILES | NCCC=Cc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C11H13N3S/c12-6-2-1-3-8-4-5-9-10(7-8)15-11(13)14-9/h1,3-5,7H,2,6,12H2,(H2,13,14) |
| InChIKey | FOARPLUURCKACR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |