About 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine
6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine (PubChem CID 169475647) has the molecular formula C10H9BrN2S
and a molecular weight of 269.17 g/mol. Its IUPAC name is 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 169475647 |
| Molecular Formula | C10H9BrN2S |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(C=CCBr)cc2s1 |
| InChI | InChI=1S/C10H9BrN2S/c11-5-1-2-7-3-4-8-9(6-7)14-10(12)13-8/h1-4,6H,5H2,(H2,12,13) |
| InChIKey | QLNVSGOECJLGRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine?
The IUPAC name of 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine (CID 169475647) is 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine is Nc1nc2ccc(C=CCBr)cc2s1.
What is the InChIKey of 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine?
The InChIKey is QLNVSGOECJLGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2S/c11-5-1-2-7-3-4-8-9(6-7)14-10(12)13-8/h1-4,6H,5H2,(H2,12,13).
What are the key properties of 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine?
6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine has a molecular weight of 269.17 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromoprop-1-enyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 169475647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).