C12H10FNO2 — CID 170483931
4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enoic acid (PubChem CID 170483931) has the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. Its IUPAC name is 4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enoic acid.
| Compound Name | 4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 170483931 |
| Molecular Formula | C12H10FNO2 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enoic acid |
| SMILES | N#CCc1ccc(F)cc1C=CCC(=O)O |
| InChI | InChI=1S/C12H10FNO2/c13-11-5-4-9(6-7-14)10(8-11)2-1-3-12(15)16/h1-2,4-5,8H,3,6H2,(H,15,16) |
| InChIKey | VYPVLOQTRCCMSG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |